| CAS ID | 117924-33-1 |
|---|---|
| IUPAC Name | N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-ethylethanamine |
| Molecular Formula | C12H28NO2P |
| Molecular Weight | |
| SMILES | CCN(CC)P(OC(C)(C)C)OC(C)(C)C |
| CAS ID | 117924-33-1 |
|---|---|
| IUPAC Name | N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-ethylethanamine |
| Molecular Formula | C12H28NO2P |
| Molecular Weight | |
| SMILES | CCN(CC)P(OC(C)(C)C)OC(C)(C)C |
| 4251849 |
Synonym:di-tert-butyl n,n-diethylphosphoramidite, di-tert-butyl diethylphosphoramidite, di-t-butyl n,n-diethylphosphoramidite, phosphoramidous acid, diethyl-, bis 1,1-dimethylethyl ester, n-bis 2-methylpropan-2-yl oxy phosphanyl-n-ethylethanamine, acmc-1c42i, di-t-butyl diethylphosphoramidite, di-tert-butyl diethylamidophosphite, di-tert-butoxy diethylamino phosphine
| Density | 0.896 |
| Boiling Point | 39°C to 41°C (0.3mmHg) |
| Flash Point | 78°C (172°F) |
| Refractive Index | 1.434 |
| Solubility Information | Hydrolyzes in water. Soluble in chloroform and methanol. |
| Sensitivity | Moisture sensitive; May form a precipitate |
| Formula Weight | 249.33 |
| Chemical Name or Material | Di-tert-butyl N,N-diethylphosphoramidite |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
