| CAS ID | 5339-26-4 |
|---|---|
| IUPAC Name | 1-(2-bromoethyl)-4-nitrobenzene |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1CCBr)[N+](=O)[O-] |
| CAS ID | 5339-26-4 |
|---|---|
| IUPAC Name | 1-(2-bromoethyl)-4-nitrobenzene |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1CCBr)[N+](=O)[O-] |
| 79266 |
Synonym:4-nitrophenethyl bromide, 1-2-bromoethyl-4-nitrobenzene, benzene, 1-2-bromoethyl-4-nitro, 4-nitrophenethylbromide, p-nitrophenethyl bromide, 2-4-nitrophenyl ethyl bromide, 4-2-bromoethyl nitrobenzene, 4-nitrophenylethyl bromide, .beta.-p-nitrophenyl ethyl bromide, phenethylbromide4nitro
| Color | Undesignated |
| Melting Point | 69°C |
| Formula Weight | 230.06 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(4-Nitrophenyl)ethyl Bromide |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
