| CAS ID | 24801-88-5 |
|---|---|
| IUPAC Name | triethoxy(3-isocyanatopropyl)silane |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| CAS ID | 24801-88-5 |
|---|---|
| IUPAC Name | triethoxy(3-isocyanatopropyl)silane |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| 90613 |
Synonym: 3-isocyanatopropyltriethoxysilane, triethoxy 3-isocyanatopropyl silane, 3-isocyanatopropyl triethoxysilane, isocyanatopropyltriethoxysilane, 3-triethoxysilyl propyl isocyanate, silane, triethoxy 3-isocyanatopropyl, unii-9br6002p6e, isocyanic acid, 3-triethoxysilyl propylester, isocyanic acid, 3-triethoxysilyl propyl ester, icptes
| Specific Gravity | 0.99 |
| Infrared Spectrum | Authentic |
| Boiling Point | 130.0°C (20.0 mmHg) |
| Refractive Index | 1.4190 to 1.4220 (20°C, 589nm) |
| Color | Colorless to Yellow |
| Packaging | Glass bottle |
| Density | 0.9900g/mL |
| Flash Point | 77°C |
| CAS Min % | 94.0 |
| CAS Max % | 100.0 |
| Assay Percent Range | 94% min. (GC) |
| Linear Formula | (CH3CH2O)3Si(CH2)3NCO |
| Solubility Information | Solubility in water: reacts |
| Formula Weight | 247.37 |
| Physical Form | Liquid |
| Chemical Name or Material | (3-Isocyanatopropyl)triethoxysilane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
