| CAS ID | 82799-44-8 |
|---|---|
| IUPAC Name | 2,4-diethylthioxanthen-9-one |
| Molecular Formula | C17H16OS |
| Molecular Weight | |
| SMILES | CCC1=CC(=C2C(=C1)C(=O)C3=CC=CC=C3S2)CC |
| CAS ID | 82799-44-8 |
|---|---|
| IUPAC Name | 2,4-diethylthioxanthen-9-one |
| Molecular Formula | C17H16OS |
| Molecular Weight | |
| SMILES | CCC1=CC(=C2C(=C1)C(=O)C3=CC=CC=C3S2)CC |
| 122825 |
| Color | Yellow |
| Melting Point | 70°C |
| Formula Weight | 268.37 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,4-Diethylthioxanthen-9-one |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
