| CAS ID | 778-22-3 |
|---|---|
| IUPAC Name | 2-phenylpropan-2-ylbenzene |
| Molecular Formula | C15H16 |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| CAS ID | 778-22-3 |
|---|---|
| IUPAC Name | 2-phenylpropan-2-ylbenzene |
| Molecular Formula | C15H16 |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| 13065 |
Synonym: 2,2-diphenylpropane, unii-ov5r1azu4n, propane, 2,2-diphenyl, dimethyldiphenylmethane, ov5r1azu4n, propane-2,2-diyldibenzene, benzene, 1,1′-1-methylethylidene bis, 2-phenylpropan-2-yl benzene, 2′,2′-diphenylpropane, 22dpp
| Refractive Index | 1.5690 to 1.5710 (20°C, 589nm) |
| Density | 0.99 |
| Infrared Spectrum | Authentic |
| Color | Colorless to Yellow |
| CAS Min % | 96.0 |
| CAS Max % | 100.0 |
| Linear Formula | CH3C(C6H5)2CH3 |
| Beilstein | 05, 614 |
| Formula Weight | 196.29 |
| Physical Form | Liquid After Melting |
| Chemical Name or Material | 2, 2-Diphenylpropane, 97% |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
