| CAS ID | 2688-84-8 |
|---|---|
| IUPAC Name | 2-Phenoxyaniline |
| Molecular Formula | C12H11NO |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2N |
| CAS ID | 2688-84-8 |
|---|---|
| IUPAC Name | 2-Phenoxyaniline |
| Molecular Formula | C12H11NO |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2N |
| 75899 |
Synonym: 2-aminodiphenyl ether, o-phenoxyaniline, 2-aminophenyl phenyl ether, benzenamine, 2-phenoxy, 2-ade, 2-phenoxybenzenamine, o-aminophenyl phenyl ether, aniline, 2-phenoxy, aniline, o-phenoxy, 2-phonoxyaniline
| Melting Point | 46°C |
| Boiling Point | 187°C |
| Color | Undesignated |
| Formula Weight | 185.23 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Aminodiphenyl Ether |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
